ChemNet > CAS > 261763-39-7 2,6-Difluoro-3-methylbenzoyl chloride
261763-39-7 2,6-Difluoro-3-methylbenzoyl chloride
Nama produk |
2,6-Difluoro-3-methylbenzoyl chloride |
Sinonim |
2,6-Difluoro-m-toluoyl chloride |
MF |
C8H5ClF2O |
Berat Molekul |
190.5745 |
InChI |
InChI=1/C8H5ClF2O/c1-4-2-3-5(10)6(7(4)11)8(9)12/h2-3H,1H3 |
CAS NO |
261763-39-7 |
Struktur Molekul |
|
Kepadatan |
1.356g/cm3 |
Titik didih |
203.1°C at 760 mmHg |
Indeks bias |
1.499 |
Titik nyala |
76.7°C |
Simbol bahaya |
|
Kode Risiko |
R34:Causes burns.;
|
Keselamatan Deskripsi |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|